C13H19N2O2+ — CID 141358533
2,3-bis(2-methoxyethyl)-1H-benzimidazol-3-ium (PubChem CID 141358533) has the molecular formula C13H19N2O2+ and a molecular weight of 235.31 g/mol. Its IUPAC name is 2,3-bis(2-methoxyethyl)-1H-benzimidazol-3-ium.
| Compound Name | 2,3-bis(2-methoxyethyl)-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 141358533 |
| Molecular Formula | C13H19N2O2+ |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2,3-bis(2-methoxyethyl)-1H-benzimidazol-3-ium |
| SMILES | COCCc1[nH]c2ccccc2[n+]1CCOC |
| InChI | InChI=1S/C13H18N2O2/c1-16-9-7-13-14-11-5-3-4-6-12(11)15(13)8-10-17-2/h3-6H,7-10H2,1-2H3/p+1 |
| InChIKey | LEUXXPUKSVHGAF-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|