C10H16NO+ — CID 58173165
1-(2-methoxyethyl)-2,6-dimethylpyridin-1-ium (PubChem CID 58173165) has the molecular formula C10H16NO+ and a molecular weight of 166.24 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,6-dimethylpyridin-1-ium.
| Compound Name | 1-(2-methoxyethyl)-2,6-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 58173165 |
| Molecular Formula | C10H16NO+ |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-(2-methoxyethyl)-2,6-dimethylpyridin-1-ium |
| SMILES | COCC[n+]1c(C)cccc1C |
| InChI | InChI=1S/C10H16NO/c1-9-5-4-6-10(2)11(9)7-8-12-3/h4-6H,7-8H2,1-3H3/q+1 |
| InChIKey | SDRWOVADVXSRSM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|