C11H18BrN — CID 57350079
1-butyl-2,6-dimethylpyridin-1-ium bromide (PubChem CID 57350079) has the molecular formula C11H18BrN and a molecular weight of 244.18 g/mol. Its IUPAC name is 1-butyl-2,6-dimethylpyridin-1-ium bromide.
| Compound Name | 1-butyl-2,6-dimethylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 57350079 |
| Molecular Formula | C11H18BrN |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-butyl-2,6-dimethylpyridin-1-ium bromide |
| SMILES | CCCC[n+]1c(C)cccc1C.[Br-] |
| InChI | InChI=1S/C11H18N.BrH/c1-4-5-9-12-10(2)7-6-8-11(12)3;/h6-8H,4-5,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QSCHPZVHJBCMSH-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|