C10H15Cl2NO — CID 19831653
1-chloro-3-(2,6-dimethylpyridin-1-ium-1-yl)propan-2-ol chloride (PubChem CID 19831653) has the molecular formula C10H15Cl2NO and a molecular weight of 236.14 g/mol. Its IUPAC name is 1-chloro-3-(2,6-dimethylpyridin-1-ium-1-yl)propan-2-ol chloride.
| Compound Name | 1-chloro-3-(2,6-dimethylpyridin-1-ium-1-yl)propan-2-ol chloride |
|---|---|
| PubChem CID | 19831653 |
| Molecular Formula | C10H15Cl2NO |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1-chloro-3-(2,6-dimethylpyridin-1-ium-1-yl)propan-2-ol chloride |
| SMILES | Cc1cccc(C)[n+]1CC(O)CCl.[Cl-] |
| InChI | InChI=1S/C10H15ClNO.ClH/c1-8-4-3-5-9(2)12(8)7-10(13)6-11;/h3-5,10,13H,6-7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BFRJNXAJFCCNCF-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|