C13H19N2+ — CID 4747060
2,3-dipropyl-1H-benzimidazol-3-ium (PubChem CID 4747060) has the molecular formula C13H19N2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 2,3-dipropyl-1H-benzimidazol-3-ium.
| Compound Name | 2,3-dipropyl-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 4747060 |
| Molecular Formula | C13H19N2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2,3-dipropyl-1H-benzimidazol-3-ium |
| SMILES | CCCc1[nH]c2ccccc2[n+]1CCC |
| InChI | InChI=1S/C13H18N2/c1-3-7-13-14-11-8-5-6-9-12(11)15(13)10-4-2/h5-6,8-9H,3-4,7,10H2,1-2H3/p+1 |
| InChIKey | RFQGGISTRHNFKH-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|