C17H17Cl2N2+ — CID 4746900
3-[(2,4-dichlorophenyl)methyl]-2-propyl-1H-benzimidazol-3-ium (PubChem CID 4746900) has the molecular formula C17H17Cl2N2+ and a molecular weight of 320.24 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-2-propyl-1H-benzimidazol-3-ium.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-2-propyl-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 4746900 |
| Molecular Formula | C17H17Cl2N2+ |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-2-propyl-1H-benzimidazol-3-ium |
| SMILES | CCCc1[nH]c2ccccc2[n+]1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2/c1-2-5-17-20-15-6-3-4-7-16(15)21(17)11-12-8-9-13(18)10-14(12)19/h3-4,6-10H,2,5,11H2,1H3/p+1 |
| InChIKey | HMIJLLTYFWXTKC-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|