C26H22ClFN4O — CID 141359197
N-[5-(chloromethyl)-2-methylphenyl]-3-fluoro-4-[(5-methyl-4-phenylpyrimidin-2-yl)amino]benzamide (PubChem CID 141359197) has the molecular formula C26H22ClFN4O and a molecular weight of 460.94 g/mol. Its IUPAC name is N-[5-(chloromethyl)-2-methylphenyl]-3-fluoro-4-[(5-methyl-4-phenylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-[5-(chloromethyl)-2-methylphenyl]-3-fluoro-4-[(5-methyl-4-phenylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 141359197 |
| Molecular Formula | C26H22ClFN4O |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[5-(chloromethyl)-2-methylphenyl]-3-fluoro-4-[(5-methyl-4-phenylpyrimidin-2-yl)amino]benzamide |
| SMILES | Cc1ccc(CCl)cc1NC(=O)c1ccc(Nc2ncc(C)c(-c3ccccc3)n2)c(F)c1 |
| InChI | InChI=1S/C26H22ClFN4O/c1-16-8-9-18(14-27)12-23(16)30-25(33)20-10-11-22(21(28)13-20)31-26-29-15-17(2)24(32-26)19-6-4-3-5-7-19/h3-13,15H,14H2,1-2H3,(H,30,33)(H,29,31,32) |
| InChIKey | ZSXDFPTVYLMUME-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|