C17H17FN2O5S — CID 141363354
3-fluoro-N-[4-[[(2S,3S)-2-hydroxyoxolan-3-yl]sulfamoyl]phenyl]benzamide (PubChem CID 141363354) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-fluoro-N-[4-[[(2S,3S)-2-hydroxyoxolan-3-yl]sulfamoyl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-[[(2S,3S)-2-hydroxyoxolan-3-yl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 141363354 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-fluoro-N-[4-[[(2S,3S)-2-hydroxyoxolan-3-yl]sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N[C@H]2CCO[C@@H]2O)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H17FN2O5S/c18-12-3-1-2-11(10-12)16(21)19-13-4-6-14(7-5-13)26(23,24)20-15-8-9-25-17(15)22/h1-7,10,15,17,20,22H,8-9H2,(H,19,21)/t15-,17-/m0/s1 |
| InChIKey | ZHWAFYQTXMRBLL-RDJZCZTQSA-N |
| XLogP | 1.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |