C10H20S6 — CID 141366875
cyclopentane-1,1,2-trithiol (PubChem CID 141366875) has the molecular formula C10H20S6 and a molecular weight of 332.67 g/mol. Its IUPAC name is cyclopentane-1,1,2-trithiol.
| Compound Name | cyclopentane-1,1,2-trithiol |
|---|---|
| PubChem CID | 141366875 |
| Molecular Formula | C10H20S6 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | cyclopentane-1,1,2-trithiol |
| SMILES | SC1CCCC1(S)S.SC1CCCC1(S)S |
| InChI | InChI=1S/2C5H10S3/c2*6-4-2-1-3-5(4,7)8/h2*4,6-8H,1-3H2 |
| InChIKey | YTLMTQSFRFSWKG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|