C8H16S2 — CID 87150562
1-ethylcyclohexane-1,2-dithiol (PubChem CID 87150562) has the molecular formula C8H16S2 and a molecular weight of 176.35 g/mol. Its IUPAC name is 1-ethylcyclohexane-1,2-dithiol.
| Compound Name | 1-ethylcyclohexane-1,2-dithiol |
|---|---|
| PubChem CID | 87150562 |
| Molecular Formula | C8H16S2 |
| Molecular Weight | 176.35 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1-ethylcyclohexane-1,2-dithiol |
| SMILES | CCC1(S)CCCCC1S |
| InChI | InChI=1S/C8H16S2/c1-2-8(10)6-4-3-5-7(8)9/h7,9-10H,2-6H2,1H3 |
| InChIKey | PSSHPVCYZIHSIL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|