C14H17Br5 — CID 141369062
1,1,8,8,8-pentabromooctylbenzene (PubChem CID 141369062) has the molecular formula C14H17Br5 and a molecular weight of 584.81 g/mol. Its IUPAC name is 1,1,8,8,8-pentabromooctylbenzene.
| Compound Name | 1,1,8,8,8-pentabromooctylbenzene |
|---|---|
| PubChem CID | 141369062 |
| Molecular Formula | C14H17Br5 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 579.72 |
| IUPAC Name | 1,1,8,8,8-pentabromooctylbenzene |
| SMILES | BrC(Br)(Br)CCCCCCC(Br)(Br)c1ccccc1 |
| InChI | InChI=1S/C14H17Br5/c15-13(16,12-8-4-3-5-9-12)10-6-1-2-7-11-14(17,18)19/h3-5,8-9H,1-2,6-7,10-11H2 |
| InChIKey | YDRIFUVXFAZJML-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|