C6H8Br6 — CID 154416999
1,1,1,6,6,6-hexabromohexane (PubChem CID 154416999) has the molecular formula C6H8Br6 and a molecular weight of 559.55 g/mol. Its IUPAC name is 1,1,1,6,6,6-hexabromohexane.
| Compound Name | 1,1,1,6,6,6-hexabromohexane |
|---|---|
| PubChem CID | 154416999 |
| Molecular Formula | C6H8Br6 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 553.57 |
| IUPAC Name | 1,1,1,6,6,6-hexabromohexane |
| SMILES | BrC(Br)(Br)CCCCC(Br)(Br)Br |
| InChI | InChI=1S/C6H8Br6/c7-5(8,9)3-1-2-4-6(10,11)12/h1-4H2 |
| InChIKey | QMQCWLCVGYIFNW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|