C11H21Br3O3 — CID 57231335
2-butoxy-1-(5,5,5-tribromopentoxy)ethanol (PubChem CID 57231335) has the molecular formula C11H21Br3O3 and a molecular weight of 441.00 g/mol. Its IUPAC name is 2-butoxy-1-(5,5,5-tribromopentoxy)ethanol.
| Compound Name | 2-butoxy-1-(5,5,5-tribromopentoxy)ethanol |
|---|---|
| PubChem CID | 57231335 |
| Molecular Formula | C11H21Br3O3 |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 437.90 |
| IUPAC Name | 2-butoxy-1-(5,5,5-tribromopentoxy)ethanol |
| SMILES | CCCCOCC(O)OCCCCC(Br)(Br)Br |
| InChI | InChI=1S/C11H21Br3O3/c1-2-3-7-16-9-10(15)17-8-5-4-6-11(12,13)14/h10,15H,2-9H2,1H3 |
| InChIKey | GJLZKBPJQOUSDW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|