About 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid
2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid (PubChem CID 141371405) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid |
| PubChem CID | 141371405 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid |
| SMILES | O=C(O)C1C2CC3CC(C2)NC1C3 |
| InChI | InChI=1S/C10H15NO2/c12-10(13)9-6-1-5-2-7(4-6)11-8(9)3-5/h5-9,11H,1-4H2,(H,12,13) |
| InChIKey | GGCXSUJLAJJTIO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid?
The IUPAC name of 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid (CID 141371405) is 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid.
What is the SMILES notation for 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid?
The canonical SMILES for 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid is O=C(O)C1C2CC3CC(C2)NC1C3.
What is the InChIKey of 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid?
The InChIKey is GGCXSUJLAJJTIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c12-10(13)9-6-1-5-2-7(4-6)11-8(9)3-5/h5-9,11H,1-4H2,(H,12,13).
What are the key properties of 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid?
2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid has a molecular weight of 181.23 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid is sourced from PubChem (CID 141371405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).