C14H19NO3 — CID 141372751
N-benzyl-N-[(1S)-1-(2,2-dimethyl-1,3-dioxol-4-yl)ethyl]hydroxylamine (PubChem CID 141372751) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-1-(2,2-dimethyl-1,3-dioxol-4-yl)ethyl]hydroxylamine.
| Compound Name | N-benzyl-N-[(1S)-1-(2,2-dimethyl-1,3-dioxol-4-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 141372751 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-benzyl-N-[(1S)-1-(2,2-dimethyl-1,3-dioxol-4-yl)ethyl]hydroxylamine |
| SMILES | C[C@@H](C1=COC(C)(C)O1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-11(13-10-17-14(2,3)18-13)15(16)9-12-7-5-4-6-8-12/h4-8,10-11,16H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | ZCVHXMAXGFWARJ-NSHDSACASA-N |
| XLogP | 2.89 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|