C20H19F3O5 — CID 141372802
2-[2-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]methoxy]phenyl]-3-methyloxiran-2-yl]acetic acid (PubChem CID 141372802) has the molecular formula C20H19F3O5 and a molecular weight of 396.36 g/mol. Its IUPAC name is 2-[2-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]methoxy]phenyl]-3-methyloxiran-2-yl]acetic acid.
| Compound Name | 2-[2-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]methoxy]phenyl]-3-methyloxiran-2-yl]acetic acid |
|---|---|
| PubChem CID | 141372802 |
| Molecular Formula | C20H19F3O5 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[2-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]methoxy]phenyl]-3-methyloxiran-2-yl]acetic acid |
| SMILES | COc1ccc(C(F)(F)F)cc1COc1ccc(C2(CC(=O)O)OC2C)cc1 |
| InChI | InChI=1S/C20H19F3O5/c1-12-19(28-12,10-18(24)25)14-3-6-16(7-4-14)27-11-13-9-15(20(21,22)23)5-8-17(13)26-2/h3-9,12H,10-11H2,1-2H3,(H,24,25) |
| InChIKey | HSBIYXJAECYTOD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|