C21H25ClN4 — CID 141375005
N-[[5-(6-chloro-1-methylindol-2-yl)-3-pyridinyl]methyl]-1-methylpiperidin-4-amine (PubChem CID 141375005) has the molecular formula C21H25ClN4 and a molecular weight of 368.91 g/mol. Its IUPAC name is N-[[5-(6-chloro-1-methylindol-2-yl)-3-pyridinyl]methyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[[5-(6-chloro-1-methylindol-2-yl)-3-pyridinyl]methyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 141375005 |
| Molecular Formula | C21H25ClN4 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[[5-(6-chloro-1-methylindol-2-yl)-3-pyridinyl]methyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NCc2cncc(-c3cc4ccc(Cl)cc4n3C)c2)CC1 |
| InChI | InChI=1S/C21H25ClN4/c1-25-7-5-19(6-8-25)24-13-15-9-17(14-23-12-15)20-10-16-3-4-18(22)11-21(16)26(20)2/h3-4,9-12,14,19,24H,5-8,13H2,1-2H3 |
| InChIKey | LBBISXQGBCWXAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |