C33H41FN8O3 — CID 141375654
1-[(E)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea (PubChem CID 141375654) has the molecular formula C33H41FN8O3 and a molecular weight of 616.74 g/mol. Its IUPAC name is 1-[(E)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea.
| Compound Name | 1-[(E)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 141375654 |
| Molecular Formula | C33H41FN8O3 |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | 1-[(E)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea |
| SMILES | CN(C)CCn1cnnc1-c1cc(Oc2ccc(N(/N=C/c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)C(N)=O)cc2F)ccn1 |
| InChI | InChI=1S/C33H41FN8O3/c1-32(2,3)22-15-21(29(43)25(16-22)33(4,5)6)19-38-42(31(35)44)23-9-10-28(26(34)17-23)45-24-11-12-36-27(18-24)30-39-37-20-41(30)14-13-40(7)8/h9-12,15-20,43H,13-14H2,1-8H3,(H2,35,44)/b38-19+ |
| InChIKey | XEIAPNUGUXONCG-OEPDXVHDSA-N |
| XLogP | 6.05 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|