C25H24FN9O5 — CID 90676558
[2-[(E)-[[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]carbamoylhydrazinylidene]methyl]phenyl] nitrate (PubChem CID 90676558) has the molecular formula C25H24FN9O5 and a molecular weight of 549.52 g/mol. Its IUPAC name is [2-[(E)-[[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]carbamoylhydrazinylidene]methyl]phenyl] nitrate.
| Compound Name | [2-[(E)-[[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]carbamoylhydrazinylidene]methyl]phenyl] nitrate |
|---|---|
| PubChem CID | 90676558 |
| Molecular Formula | C25H24FN9O5 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [2-[(E)-[[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]carbamoylhydrazinylidene]methyl]phenyl] nitrate |
| SMILES | CN(C)CCn1cnnc1-c1cc(Oc2ccc(NC(=O)N/N=C/c3ccccc3O[N+](=O)[O-])cc2F)ccn1 |
| InChI | InChI=1S/C25H24FN9O5/c1-33(2)11-12-34-16-29-31-24(34)21-14-19(9-10-27-21)39-23-8-7-18(13-20(23)26)30-25(36)32-28-15-17-5-3-4-6-22(17)40-35(37)38/h3-10,13-16H,11-12H2,1-2H3,(H2,30,32,36)/b28-15+ |
| InChIKey | AGCAIFFALBJUIZ-RWPZCVJISA-N |
| XLogP | 3.56 |
| TPSA | 161.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|