C25H24F2N8O2 — CID 90676549
1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]urea (PubChem CID 90676549) has the molecular formula C25H24F2N8O2 and a molecular weight of 506.52 g/mol. Its IUPAC name is 1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]urea.
| Compound Name | 1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 90676549 |
| Molecular Formula | C25H24F2N8O2 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]urea |
| SMILES | CN(C)CCn1cnnc1-c1cc(Oc2ccc(NC(=O)N/N=C/c3ccc(F)cc3)cc2F)ccn1 |
| InChI | InChI=1S/C25H24F2N8O2/c1-34(2)11-12-35-16-30-32-24(35)22-14-20(9-10-28-22)37-23-8-7-19(13-21(23)27)31-25(36)33-29-15-17-3-5-18(26)6-4-17/h3-10,13-16H,11-12H2,1-2H3,(H2,31,33,36)/b29-15+ |
| InChIKey | ASBJBQZTHWZUNT-WKULSOCRSA-N |
| XLogP | 4.13 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|