C21H48AlO6P3 — CID 141377493
tris[[tert-butyl(propan-2-yl)phosphoryl]oxy]alumane (PubChem CID 141377493) has the molecular formula C21H48AlO6P3 and a molecular weight of 516.51 g/mol. Its IUPAC name is tris[[tert-butyl(propan-2-yl)phosphoryl]oxy]alumane.
| Compound Name | tris[[tert-butyl(propan-2-yl)phosphoryl]oxy]alumane |
|---|---|
| PubChem CID | 141377493 |
| Molecular Formula | C21H48AlO6P3 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | tris[[tert-butyl(propan-2-yl)phosphoryl]oxy]alumane |
| SMILES | CC(C)P(=O)(O[Al](OP(=O)(C(C)C)C(C)(C)C)OP(=O)(C(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/3C7H17O2P.Al/c3*1-6(2)10(8,9)7(3,4)5;/h3*6H,1-5H3,(H,8,9);/q;;;+3/p-3 |
| InChIKey | WGIBOCXMYVSZEC-UHFFFAOYSA-K |
| XLogP | 8.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|