C15H20N2O2 — CID 141377726
8-(3-cyclopropyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 141377726) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 8-(3-cyclopropyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(3-cyclopropyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 141377726 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 8-(3-cyclopropyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | c1cnc(N2CCC3(CC2)OCCO3)c(C2CC2)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-13(12-3-4-12)14(16-7-1)17-8-5-15(6-9-17)18-10-11-19-15/h1-2,7,12H,3-6,8-11H2 |
| InChIKey | FUCMINLOWCIIHL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |