C12H15N2O2Si — CID 70338598
CID 70338598 (PubChem CID 70338598) has the molecular formula C12H15N2O2Si and a molecular weight of 247.35 g/mol.
| Compound Name | CID 70338598 |
|---|---|
| PubChem CID | 70338598 |
| Molecular Formula | C12H15N2O2Si |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | — |
| SMILES | [Si]c1cccnc1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H15N2O2Si/c17-10-2-1-5-13-11(10)14-6-3-12(4-7-14)15-8-9-16-12/h1-2,5H,3-4,6-9H2 |
| InChIKey | SMJKBLXVAFZPMC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|