C15H20O4 — CID 141377778
(5-ethyl-3,6-dioxoocta-1,7-dien-4-yl) (E)-2-methylbut-2-enoate (PubChem CID 141377778) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (5-ethyl-3,6-dioxoocta-1,7-dien-4-yl) (E)-2-methylbut-2-enoate.
| Compound Name | (5-ethyl-3,6-dioxoocta-1,7-dien-4-yl) (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 141377778 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (5-ethyl-3,6-dioxoocta-1,7-dien-4-yl) (E)-2-methylbut-2-enoate |
| SMILES | C=CC(=O)C(CC)C(OC(=O)/C(C)=C/C)C(=O)C=C |
| InChI | InChI=1S/C15H20O4/c1-6-10(5)15(18)19-14(13(17)9-4)11(7-2)12(16)8-3/h6,8-9,11,14H,3-4,7H2,1-2,5H3/b10-6+ |
| InChIKey | NHLKNCXAYBPZCQ-UXBLZVDNSA-N |
| XLogP | 2.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|