C17H20O7 — CID 10427111
(4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5-dioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone (PubChem CID 10427111) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5-dioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone.
| Compound Name | (4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5-dioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone |
|---|---|
| PubChem CID | 10427111 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5-dioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone |
| SMILES | C[C@@H]1CC(=O)O[C@@H](C)C(=O)/C=C/C(=O)C[C@H](C)C(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C17H20O7/c1-10-8-13(18)4-5-15(20)12(3)24-17(22)9-11(2)23-16(21)7-6-14(10)19/h4-7,10-12H,8-9H2,1-3H3/b5-4+,7-6+/t10-,11+,12-/m0/s1 |
| InChIKey | ZLAAYLNWOWJATD-UKSURNRTSA-N |
| XLogP | 1.10 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |