C12H6N2O2S — CID 141380406
4,6-dihydroxy-2-thiophen-3-ylbenzene-1,3-dicarbonitrile (PubChem CID 141380406) has the molecular formula C12H6N2O2S and a molecular weight of 242.26 g/mol. Its IUPAC name is 4,6-dihydroxy-2-thiophen-3-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 4,6-dihydroxy-2-thiophen-3-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 141380406 |
| Molecular Formula | C12H6N2O2S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4,6-dihydroxy-2-thiophen-3-ylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(O)cc(O)c(C#N)c1-c1ccsc1 |
| InChI | InChI=1S/C12H6N2O2S/c13-4-8-10(15)3-11(16)9(5-14)12(8)7-1-2-17-6-7/h1-3,6,15-16H |
| InChIKey | HMCMSTBSWBVWFV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |