C13H10N2S2 — CID 178081699
2-sulfanylidene-4-thiophen-3-yl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carbonitrile (PubChem CID 178081699) has the molecular formula C13H10N2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-sulfanylidene-4-thiophen-3-yl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 2-sulfanylidene-4-thiophen-3-yl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 178081699 |
| Molecular Formula | C13H10N2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-sulfanylidene-4-thiophen-3-yl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccsc2)c2c([nH]c1=S)CCC2 |
| InChI | InChI=1S/C13H10N2S2/c14-6-10-12(8-4-5-17-7-8)9-2-1-3-11(9)15-13(10)16/h4-5,7H,1-3H2,(H,15,16) |
| InChIKey | XERRJKQFGGYWAU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|