C11H9N3S — CID 121212434
5-cyclopropyl-3-thiophen-3-yl-1H-pyrazole-4-carbonitrile (PubChem CID 121212434) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 5-cyclopropyl-3-thiophen-3-yl-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-cyclopropyl-3-thiophen-3-yl-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 121212434 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 5-cyclopropyl-3-thiophen-3-yl-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccsc2)n[nH]c1C1CC1 |
| InChI | InChI=1S/C11H9N3S/c12-5-9-10(7-1-2-7)13-14-11(9)8-3-4-15-6-8/h3-4,6-7H,1-2H2,(H,13,14) |
| InChIKey | RVXYFFRMZNCASI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |