C17H18N4S — CID 22953836
4-(5-piperidin-4-yl-3-thiophen-3-yl-1H-pyrazol-4-yl)pyridine (PubChem CID 22953836) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 4-(5-piperidin-4-yl-3-thiophen-3-yl-1H-pyrazol-4-yl)pyridine.
| Compound Name | 4-(5-piperidin-4-yl-3-thiophen-3-yl-1H-pyrazol-4-yl)pyridine |
|---|---|
| PubChem CID | 22953836 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 4-(5-piperidin-4-yl-3-thiophen-3-yl-1H-pyrazol-4-yl)pyridine |
| SMILES | c1cc(-c2c(-c3ccsc3)n[nH]c2C2CCNCC2)ccn1 |
| InChI | InChI=1S/C17H18N4S/c1-6-18-7-2-12(1)15-16(13-3-8-19-9-4-13)20-21-17(15)14-5-10-22-11-14/h1-2,5-7,10-11,13,19H,3-4,8-9H2,(H,20,21) |
| InChIKey | HXJDELVIVUTAFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |