C26H30N2O5S2 — CID 141381053
1-cyclohexyl-3-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)sulfonyl]thiourea (PubChem CID 141381053) has the molecular formula C26H30N2O5S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)sulfonyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)sulfonyl]thiourea |
|---|---|
| PubChem CID | 141381053 |
| Molecular Formula | C26H30N2O5S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 1-cyclohexyl-3-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)sulfonyl]thiourea |
| SMILES | Cc1c(S(=O)(=O)NC(=S)NC2CCCCC2)oc2c1C(=O)C(=O)c1c-2ccc2c1CCCC2(C)C |
| InChI | InChI=1S/C26H30N2O5S2/c1-14-19-21(29)22(30)20-16-10-7-13-26(2,3)18(16)12-11-17(20)23(19)33-24(14)35(31,32)28-25(34)27-15-8-5-4-6-9-15/h11-12,15H,4-10,13H2,1-3H3,(H2,27,28,34) |
| InChIKey | ZBMQCUMKNJUVEY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|