C21H26N2O4S — CID 141382407
tert-butyl N-[(2R,3R)-6-(3-methoxyphenoxy)-2-sulfanyl-1,2,3,4-tetrahydroquinolin-3-yl]carbamate (PubChem CID 141382407) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-6-(3-methoxyphenoxy)-2-sulfanyl-1,2,3,4-tetrahydroquinolin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-6-(3-methoxyphenoxy)-2-sulfanyl-1,2,3,4-tetrahydroquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 141382407 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | tert-butyl N-[(2R,3R)-6-(3-methoxyphenoxy)-2-sulfanyl-1,2,3,4-tetrahydroquinolin-3-yl]carbamate |
| SMILES | COc1cccc(Oc2ccc3c(c2)C[C@@H](NC(=O)OC(C)(C)C)[C@@H](S)N3)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-21(2,3)27-20(24)23-18-11-13-10-16(8-9-17(13)22-19(18)28)26-15-7-5-6-14(12-15)25-4/h5-10,12,18-19,22,28H,11H2,1-4H3,(H,23,24)/t18-,19-/m1/s1 |
| InChIKey | WRVXJGFGSZFYBQ-RTBURBONSA-N |
| XLogP | 4.60 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|