C11H18O4 — CID 141382911
methyl 2,2,6,6-tetramethyl-5-oxooxane-3-carboxylate (PubChem CID 141382911) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl 2,2,6,6-tetramethyl-5-oxooxane-3-carboxylate.
| Compound Name | methyl 2,2,6,6-tetramethyl-5-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 141382911 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl 2,2,6,6-tetramethyl-5-oxooxane-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C11H18O4/c1-10(2)7(9(13)14-5)6-8(12)11(3,4)15-10/h7H,6H2,1-5H3 |
| InChIKey | BCJNSKZWEPJDIO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |