C19H20N6O2S — CID 141383229
N-cyclopentyl-8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine (PubChem CID 141383229) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is N-cyclopentyl-8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine.
| Compound Name | N-cyclopentyl-8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine |
|---|---|
| PubChem CID | 141383229 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-cyclopentyl-8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine |
| SMILES | Cc1ccccc1S(=O)(=O)c1nc2[nH]ccc2n2c(NC3CCCC3)nnc12 |
| InChI | InChI=1S/C19H20N6O2S/c1-12-6-2-5-9-15(12)28(26,27)18-17-23-24-19(21-13-7-3-4-8-13)25(17)14-10-11-20-16(14)22-18/h2,5-6,9-11,13,20H,3-4,7-8H2,1H3,(H,21,24) |
| InChIKey | HFUVWVRXCPFZBJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |