C13H16N2O8 — CID 141383560
8,9-dihydroxy-2-[(3R)-piperidin-3-yl]-6,11-dioxa-2-azaspiro[4.6]undecane-1,3,7,10-tetrone (PubChem CID 141383560) has the molecular formula C13H16N2O8 and a molecular weight of 328.28 g/mol. Its IUPAC name is 8,9-dihydroxy-2-[(3R)-piperidin-3-yl]-6,11-dioxa-2-azaspiro[4.6]undecane-1,3,7,10-tetrone.
| Compound Name | 8,9-dihydroxy-2-[(3R)-piperidin-3-yl]-6,11-dioxa-2-azaspiro[4.6]undecane-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 141383560 |
| Molecular Formula | C13H16N2O8 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 8,9-dihydroxy-2-[(3R)-piperidin-3-yl]-6,11-dioxa-2-azaspiro[4.6]undecane-1,3,7,10-tetrone |
| SMILES | O=C1OC2(CC(=O)N([C@@H]3CCCNC3)C2=O)OC(=O)C(O)C1O |
| InChI | InChI=1S/C13H16N2O8/c16-7-4-13(12(21)15(7)6-2-1-3-14-5-6)22-10(19)8(17)9(18)11(20)23-13/h6,8-9,14,17-18H,1-5H2/t6-,8?,9?,13?/m1/s1 |
| InChIKey | MNAZUOAFCJNGMQ-UUQGGMIRSA-N |
| XLogP | -2.98 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|