C25H24ClN7OS — CID 141384305
N-[(E)-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4-morpholin-4-yl-1H-thieno[3,2-d]pyrimidin-4-amine (PubChem CID 141384305) has the molecular formula C25H24ClN7OS and a molecular weight of 506.04 g/mol. Its IUPAC name is N-[(E)-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4-morpholin-4-yl-1H-thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4-morpholin-4-yl-1H-thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141384305 |
| Molecular Formula | C25H24ClN7OS |
| Molecular Weight | 506.04 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[(E)-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4-morpholin-4-yl-1H-thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1ccccc1Cn1c(/C=N/NC2(N3CCOCC3)N=CNc3ccsc32)nc2ccccc21 |
| InChI | InChI=1S/C25H24ClN7OS/c26-19-6-2-1-5-18(19)16-33-22-8-4-3-7-20(22)30-23(33)15-29-31-25(32-10-12-34-13-11-32)24-21(9-14-35-24)27-17-28-25/h1-9,14-15,17,31H,10-13,16H2,(H,27,28)/b29-15+ |
| InChIKey | HYAFHIMULWELAC-WKULSOCRSA-N |
| XLogP | 4.32 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|