C26H27Cl2N9O2 — CID 71537501
N-[(E)-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 71537501) has the molecular formula C26H27Cl2N9O2 and a molecular weight of 568.47 g/mol. Its IUPAC name is N-[(E)-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 71537501 |
| Molecular Formula | C26H27Cl2N9O2 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | N-[(E)-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1ccc(Cn2c(/C=N/Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)nc3ccccc32)cc1Cl |
| InChI | InChI=1S/C26H27Cl2N9O2/c27-19-6-5-18(15-20(19)28)17-37-22-4-2-1-3-21(22)30-23(37)16-29-34-24-31-25(35-7-11-38-12-8-35)33-26(32-24)36-9-13-39-14-10-36/h1-6,15-16H,7-14,17H2,(H,31,32,33,34)/b29-16+ |
| InChIKey | OXGHLQXOZJXVBQ-MUFRIFMGSA-N |
| XLogP | 3.70 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|