C22H18N6 — CID 2858565
N-[(1-benzylbenzimidazol-2-yl)methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 2858565) has the molecular formula C22H18N6 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[(1-benzylbenzimidazol-2-yl)methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(1-benzylbenzimidazol-2-yl)methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 2858565 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[(1-benzylbenzimidazol-2-yl)methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | C(=NNc1nc2ccccc2[nH]1)c1nc2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C22H18N6/c1-2-8-16(9-3-1)15-28-20-13-7-6-12-19(20)24-21(28)14-23-27-22-25-17-10-4-5-11-18(17)26-22/h1-14H,15H2,(H2,25,26,27) |
| InChIKey | KOGYFMLEUUPBTB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|