C27H28N6O2 — CID 141384817
7-anilino-3-benzyl-1-(1-prop-2-enoylpiperidin-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 141384817) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 7-anilino-3-benzyl-1-(1-prop-2-enoylpiperidin-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-anilino-3-benzyl-1-(1-prop-2-enoylpiperidin-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 141384817 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 7-anilino-3-benzyl-1-(1-prop-2-enoylpiperidin-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CCC(N2C(=O)N(Cc3ccccc3)Cc3cnc(Nc4ccccc4)nc32)CC1 |
| InChI | InChI=1S/C27H28N6O2/c1-2-24(34)31-15-13-23(14-16-31)33-25-21(17-28-26(30-25)29-22-11-7-4-8-12-22)19-32(27(33)35)18-20-9-5-3-6-10-20/h2-12,17,23H,1,13-16,18-19H2,(H,28,29,30) |
| InChIKey | BESJVITVSSKURS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|