C31H36N8O3 — CID 72712893
7-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 72712893) has the molecular formula C31H36N8O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is 7-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 72712893 |
| Molecular Formula | C31H36N8O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 7-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CC[C@H](N2C(=O)N(c3ccccc3)Cc3cnc(Nc4ccc(N5CCN(C)CC5)c(OC)c4)nc32)C1 |
| InChI | InChI=1S/C31H36N8O3/c1-4-28(40)37-13-12-25(21-37)39-29-22(20-38(31(39)41)24-8-6-5-7-9-24)19-32-30(34-29)33-23-10-11-26(27(18-23)42-3)36-16-14-35(2)15-17-36/h4-11,18-19,25H,1,12-17,20-21H2,2-3H3,(H,32,33,34)/t25-/m0/s1 |
| InChIKey | DUDFWGDXPRDGEH-VWLOTQADSA-N |
| XLogP | 3.71 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|