C25H29N7O4 — CID 139576116
4-[cyclopropyl(prop-2-enoyl)amino]-2-[3-methoxy-4-(4-prop-2-enoylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 139576116) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 4-[cyclopropyl(prop-2-enoyl)amino]-2-[3-methoxy-4-(4-prop-2-enoylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-[cyclopropyl(prop-2-enoyl)amino]-2-[3-methoxy-4-(4-prop-2-enoylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 139576116 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 4-[cyclopropyl(prop-2-enoyl)amino]-2-[3-methoxy-4-(4-prop-2-enoylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N1CCN(c2ccc(Nc3ncc(C(N)=O)c(N(C(=O)C=C)C4CC4)n3)cc2OC)CC1 |
| InChI | InChI=1S/C25H29N7O4/c1-4-21(33)31-12-10-30(11-13-31)19-9-6-16(14-20(19)36-3)28-25-27-15-18(23(26)35)24(29-25)32(17-7-8-17)22(34)5-2/h4-6,9,14-15,17H,1-2,7-8,10-13H2,3H3,(H2,26,35)(H,27,28,29) |
| InChIKey | YRVXIGBIMHGSBU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|