C29H41N8O4P — CID 163455379
2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-oxo-5-(1-prop-2-enoylpyrrolidin-3-yl)phosphanyl-1H-pyrazine-3-carboxamide (PubChem CID 163455379) has the molecular formula C29H41N8O4P and a molecular weight of 596.67 g/mol. Its IUPAC name is 2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-oxo-5-(1-prop-2-enoylpyrrolidin-3-yl)phosphanyl-1H-pyrazine-3-carboxamide.
| Compound Name | 2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-oxo-5-(1-prop-2-enoylpyrrolidin-3-yl)phosphanyl-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 163455379 |
| Molecular Formula | C29H41N8O4P |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-oxo-5-(1-prop-2-enoylpyrrolidin-3-yl)phosphanyl-1H-pyrazine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(Pc2nc(C(N)=O)c(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)c(OC)c3)[nH]c2=O)C1 |
| InChI | InChI=1S/C29H41N8O4P/c1-4-24(38)37-12-9-21(18-37)42-29-28(40)33-27(25(32-29)26(30)39)31-19-5-6-22(23(17-19)41-3)36-10-7-20(8-11-36)35-15-13-34(2)14-16-35/h4-6,17,20-21,42H,1,7-16,18H2,2-3H3,(H2,30,39)(H2,31,33,40) |
| InChIKey | BKAAVIMHIGMCLD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|