C30H46N4O7 — CID 141387126
methyl 3-(1-acetamido-3-methyl-3-phenylbutyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclobutane-1-carboxylate (PubChem CID 141387126) has the molecular formula C30H46N4O7 and a molecular weight of 574.72 g/mol. Its IUPAC name is methyl 3-(1-acetamido-3-methyl-3-phenylbutyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclobutane-1-carboxylate.
| Compound Name | methyl 3-(1-acetamido-3-methyl-3-phenylbutyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 141387126 |
| Molecular Formula | C30H46N4O7 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | methyl 3-(1-acetamido-3-methyl-3-phenylbutyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CC(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)(C(CC(C)(C)c2ccccc2)NC(C)=O)C1 |
| InChI | InChI=1S/C30H46N4O7/c1-19(35)31-22(18-29(8,9)21-14-12-11-13-15-21)30(16-20(17-30)23(36)39-10)34-24(32-25(37)40-27(2,3)4)33-26(38)41-28(5,6)7/h11-15,20,22H,16-18H2,1-10H3,(H,31,35)(H2,32,33,34,37,38) |
| InChIKey | HZGQTQVNXIPPJB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|