C28H44N2O5 — CID 141435124
methyl 3-(1-acetamido-3-benzyloctyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate (PubChem CID 141435124) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is methyl 3-(1-acetamido-3-benzyloctyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate.
| Compound Name | methyl 3-(1-acetamido-3-benzyloctyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 141435124 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | methyl 3-(1-acetamido-3-benzyloctyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate |
| SMILES | CCCCCC(Cc1ccccc1)CC(NC(C)=O)C1(NC(=O)OC(C)(C)C)CC(C(=O)OC)C1 |
| InChI | InChI=1S/C28H44N2O5/c1-7-8-10-15-22(16-21-13-11-9-12-14-21)17-24(29-20(2)31)28(18-23(19-28)25(32)34-6)30-26(33)35-27(3,4)5/h9,11-14,22-24H,7-8,10,15-19H2,1-6H3,(H,29,31)(H,30,33) |
| InChIKey | GOCBGRIQQIFNDS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|