C24H38O7 — CID 14138824
[(3R,4S,5S,6R)-4-acetyloxy-6-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]propan-2-yloxy]-5-hydroxyoxan-3-yl] acetate (PubChem CID 14138824) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4-acetyloxy-6-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]propan-2-yloxy]-5-hydroxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6R)-4-acetyloxy-6-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]propan-2-yloxy]-5-hydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 14138824 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [(3R,4S,5S,6R)-4-acetyloxy-6-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]propan-2-yloxy]-5-hydroxyoxan-3-yl] acetate |
| SMILES | C=C[C@]1(C)CC[C@@H](C(C)(C)O[C@H]2OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2O)C[C@H]1C(=C)C |
| InChI | InChI=1S/C24H38O7/c1-9-24(8)11-10-17(12-18(24)14(2)3)23(6,7)31-22-20(27)21(30-16(5)26)19(13-28-22)29-15(4)25/h9,17-22,27H,1-2,10-13H2,3-8H3/t17-,18+,19-,20+,21-,22-,24-/m1/s1 |
| InChIKey | NJQLOHXKQWKVRF-NKERXSTMSA-N |
| XLogP | 3.55 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|