C22H36O6 — CID 14756444
[2-[2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 14756444) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is [2-[2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [2-[2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 14756444 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [2-[2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)(C)C2CCC3(C)CCCC(C)=C3C2)OCC(O)C1O |
| InChI | InChI=1S/C22H36O6/c1-13-7-6-9-22(5)10-8-15(11-16(13)22)21(3,4)28-20-19(27-14(2)23)18(25)17(24)12-26-20/h15,17-20,24-25H,6-12H2,1-5H3 |
| InChIKey | QNWIDTXODBSVCO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|