C26H40O10 — CID 162816906
[(3R,4S,5R,6S)-6-[2-[(3S,3aS,5R,7aS)-3-acetyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 162816906) has the molecular formula C26H40O10 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-6-[2-[(3S,3aS,5R,7aS)-3-acetyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-6-[2-[(3S,3aS,5R,7aS)-3-acetyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 162816906 |
| Molecular Formula | C26H40O10 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [(3R,4S,5R,6S)-6-[2-[(3S,3aS,5R,7aS)-3-acetyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)(C)[C@@H]2CC[C@@]3(C)CC[C@H](C(C)=O)[C@@]3(O)C2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H40O10/c1-14(27)19-9-11-25(7)10-8-18(12-26(19,25)31)24(5,6)36-23-22(35-17(4)30)21(34-16(3)29)20(13-32-23)33-15(2)28/h18-23,31H,8-13H2,1-7H3/t18-,19-,20-,21+,22-,23+,25+,26+/m1/s1 |
| InChIKey | DUOPFVPGSBUGGE-AIUFNOAXSA-N |
| XLogP | 2.47 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|