C27H42O8 — CID 162846822
[2-[[8-formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 162846822) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is [2-[[8-formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [2-[[8-formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 162846822 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [2-[[8-formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | C=CC(C)(O)CCC1C(C)=CC(OC2OCC(O)C(O)C2OC(C)=O)C2C(C)(C=O)CCCC12C |
| InChI | InChI=1S/C27H42O8/c1-7-26(5,32)12-9-18-16(2)13-20(23-25(4,15-28)10-8-11-27(18,23)6)35-24-22(34-17(3)29)21(31)19(30)14-33-24/h7,13,15,18-24,30-32H,1,8-12,14H2,2-6H3 |
| InChIKey | JFXTVJUGZGARGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|