C25H42O6 — CID 163011705
(2S,3S,4R,5S)-2-[[(4aS,8aS)-1-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 163011705) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-[[(4aS,8aS)-1-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S)-2-[[(4aS,8aS)-1-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163011705 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (2S,3S,4R,5S)-2-[[(4aS,8aS)-1-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | C=C[C@@](C)(O)CCC1=C(CO[C@H]2OC[C@H](O)[C@@H](O)[C@@H]2O)CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C25H42O6/c1-6-24(4,29)13-10-17-16(14-30-22-21(28)20(27)18(26)15-31-22)8-9-19-23(2,3)11-7-12-25(17,19)5/h6,18-22,26-29H,1,7-15H2,2-5H3/t18-,19-,20+,21-,22-,24+,25+/m0/s1 |
| InChIKey | FEUYBLDKKNUFCH-DQLKRDFOSA-N |
| XLogP | 3.08 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|