C25H40O7 — CID 162842512
5-(3-hydroxy-3-methylpent-4-enyl)-1,4a,6-trimethyl-8-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalene-1-carbaldehyde (PubChem CID 162842512) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is 5-(3-hydroxy-3-methylpent-4-enyl)-1,4a,6-trimethyl-8-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | 5-(3-hydroxy-3-methylpent-4-enyl)-1,4a,6-trimethyl-8-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 162842512 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 5-(3-hydroxy-3-methylpent-4-enyl)-1,4a,6-trimethyl-8-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalene-1-carbaldehyde |
| SMILES | C=CC(C)(O)CCC1C(C)=CC(OC2OCC(O)C(O)C2O)C2C(C)(C=O)CCCC12C |
| InChI | InChI=1S/C25H40O7/c1-6-24(4,30)11-8-16-15(2)12-18(32-22-20(29)19(28)17(27)13-31-22)21-23(3,14-26)9-7-10-25(16,21)5/h6,12,14,16-22,27-30H,1,7-11,13H2,2-5H3 |
| InChIKey | KMMSZOQHQBPZQC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|