C25H42O8 — CID 163031544
(2R,3S,4S,5S)-2-[[(1S,4R,4aR,8S,8aR)-3,8-bis(hydroxymethyl)-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol (PubChem CID 163031544) has the molecular formula C25H42O8 and a molecular weight of 470.60 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-[[(1S,4R,4aR,8S,8aR)-3,8-bis(hydroxymethyl)-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S)-2-[[(1S,4R,4aR,8S,8aR)-3,8-bis(hydroxymethyl)-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163031544 |
| Molecular Formula | C25H42O8 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (2R,3S,4S,5S)-2-[[(1S,4R,4aR,8S,8aR)-3,8-bis(hydroxymethyl)-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol |
| SMILES | C/C(=C\CO)CC[C@H]1C(CO)=C[C@H](O[C@H]2OC[C@H](O)[C@H](O)[C@@H]2O)[C@H]2[C@@](C)(CO)CCC[C@]12C |
| InChI | InChI=1S/C25H42O8/c1-15(7-10-26)5-6-17-16(12-27)11-19(33-23-21(31)20(30)18(29)13-32-23)22-24(2,14-28)8-4-9-25(17,22)3/h7,11,17-23,26-31H,4-6,8-10,12-14H2,1-3H3/b15-7+/t17-,18-,19-,20-,21-,22-,23+,24+,25+/m0/s1 |
| InChIKey | QNDFHTCYEMSTPD-GVLOTWPTSA-N |
| XLogP | 0.88 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|